A7763258
Inosine , 10mMinDMSO , 58-63-9
Synonym(s):
(−)-Inosine;Hypoxanthine 9-β-D -ribofuranoside;Hypoxanthine Riboside;Inosine;Inosine - CAS 58-63-9 - Calbiochem
CAS NO.:58-63-9
Empirical Formula: C10H12N4O5
Molecular Weight: 268.23
MDL number: MFCD00066770
EINECS: 200-390-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-226 °C (dec.) (lit.) |
| alpha | -49.2 º (c=1,H2O 18 ºC) |
| Boiling point: | 226 C (dec.) |
| Density | 1.3846 (rough estimate) |
| refractive index | -52 ° (C=1, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | H2O: 0.5 M, clear, colorless |
| pka | 13.24±0.70(Predicted) |
| form | Crystalline Powder |
| color | White |
| PH | 1.2;8.8 |
| Odor | Odorless |
| optical activity | Consistent with structure |
| Water Solubility | 2.1 g/100 mL (20 ºC) |
| λmax | 251 (pH 0);248.5 (pH 6);253 (pH 11) |
| Merck | 14,4975 |
| BRN | 624889 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChI | 1S/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | UGQMRVRMYYASKQ-PKJMTWSGSA-N |
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3C(=O)NC=Nc23 |
| LogP | -1.970 (est) |
| CAS DataBase Reference | 58-63-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Inosine(58-63-9) |
| EPA Substance Registry System | Inosine (58-63-9) |
Description and Uses
Suppresses the increase of glucose and insulin in the blood
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 2 |
| RTECS | NM7460000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 oral in rat: > 10gm/kg |







