A7772712
4,4′,4″-Tri-tert-Butyl-2,2′:6′,2″-terpyridine , 95% , 115091-29-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB287.20 | In Stock |
|
| 1G | RMB852.80 | In Stock |
|
| 5G | RMB3704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-217 °C (lit.) |
| Boiling point: | 535.7±50.0 °C(Predicted) |
| Density | 1.004±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.57±0.42(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| InChI | InChI=1S/C27H35N3/c1-25(2,3)18-10-12-28-21(14-18)23-16-20(27(7,8)9)17-24(30-23)22-15-19(11-13-29-22)26(4,5)6/h10-17H,1-9H3 |
| InChIKey | QMABMHJGSFUTPF-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(C3=NC=CC(C(C)(C)C)=C3)=CC(C(C)(C)C)=C2)=NC=CC(C(C)(C)C)=C1 |
Description and Uses
4,4'',4''''-Tri-tert-butyl-2,2'':6'',2''''-terpyridine is a useful reagent for preparing organoplatinum(II)-based self-complementary molecular tweezers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
