A7773612
Di-p-toluoyl-D-tartaric acid monohydrate , 98% , 71607-31-3
CAS NO.：71607-31-3
Empirical Formula: C20H20O9
Molecular Weight: 404.37
MDL number: MFCD00149567
EINECS: 615-311-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 250G | RMB239.20 | In Stock |
|
| 1kg | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-165 °C(lit.) |
| alpha | 142 º (C=1 IN MEOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +142°, c = 1 in methanol |
| InChI | InChI=1/C20H18O8.H2O/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);1H2/t15-,16-;/s3 |
| InChIKey | FOTRUJUPLHRVNU-MOGJOVFKSA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](C(O)=O)OC(=O)C1=CC=C(C)C=C1)OC(=O)C1=CC=C(C)C=C1.[H]O[H] |&1:3,4,r| |
| CAS DataBase Reference | 71607-31-3(CAS DataBase Reference) |
Description and Uses
Di-p-toluoyl-d-tartaric Acid Monohydrate is a useful intermediate in the preparation of chiral rivastigmine hydrogen tartrate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
