A7774212
2,2,2-Trifluoroethyl trifluoromethanesulfonate , 95% , 6226-25-1
Synonym(s):
Trifluoromethanesulfonic acid 2,2,2-trifluoroethyl ester
CAS NO.：6226-25-1
Empirical Formula: C3H2F6O3S
Molecular Weight: 232.1
MDL number: MFCD00671579
EINECS: 458-390-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB116.00 | In Stock |
|
| 100G | RMB430.40 | In Stock |
|
| 500g | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 89-91°C |
| Density | 1,61 g/cm3 |
| refractive index | 1.3037 |
| RTECS | PB2775000 |
| Flash point: | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| color | Colorless to yellow |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C3H2F6O3S/c4-2(5,6)1-12-13(10,11)3(7,8)9/h1H2 |
| InChIKey | RTMMSCJWQYWMNK-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(OCC(F)(F)F)(=O)=O |
| CAS DataBase Reference | 6226-25-1(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, 2,2,2-trifluoroethyl ester (6226-25-1) |
Description and Uses
A fluorine-containing alkyl alkanesulfonate with cyctotoxity towards cultured leukemia L1210 cells.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314-H330 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xi,T,C |
| Risk Statements | 36/37/38-34-23/25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | TOXIC, CORROSIVE |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29055900 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
