PRODUCT Properties
| Melting point: | 233-235 °C (dec.) (lit.) |
| alpha | 4 º (c=1, 1N HCl) |
| Boiling point: | 367.79°C (rough estimate) |
| Density | 1.4160 (rough estimate) |
| refractive index | 1.5373 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), Water |
| form | crystalline |
| pka | 2.17±0.20(Predicted) |
| color | yellow to green |
| Water Solubility | insoluble |
| BRN | 2813157 |
| InChI | InChI=1S/C9H10N2O5/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16/h1-2,4,6,12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | FBTSQILOGYXGMD-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(O)C([N+]([O-])=O)=C1)N |
| CAS DataBase Reference | 621-44-3(CAS DataBase Reference) |
Description and Uses
Nitrotyrosine is formed by peroxynitrite-
3-Nitro-L-tyrosine is used as an indicator of the formation of peroxynitrite by NO-dependent oxidative damage.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29225090 |




