PRODUCT Properties
| Boiling point: | 823℃ |
| RTECS | MA1232000 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Powder |
| color | Light yellow to yellow |
| Water Solubility | Soluble in water |
| Sensitive | Hygroscopic |
| InChIKey | MSDCZRQHAGWZSH-NVZXTOETNA-N |
| SMILES | NC1=NC(N)=NC2N=CC(CN(C3C=CC(C(=O)N[C@H](C(=O)O)CCC(=O)O)=CC=3)C)=NC1=2.[NaH] |&1:19,r| |
Description and Uses
Inhibits the metabolism of folic acid
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Muta. 2 Repr. 1B Skin Irrit. 2 |






