A7784012
Tribromomethyl Phenyl Sulfone , 97% , 17025-47-7
CAS NO.：17025-47-7
Empirical Formula: C7H5Br3O2S
Molecular Weight: 392.89
MDL number: MFCD00060068
EINECS: 241-096-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB172.00 | In Stock |
|
| 100g | RMB544.00 | In Stock |
|
| 500g | RMB1951.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-147 °C(lit.) |
| Boiling point: | 373.8±42.0 °C(Predicted) |
| Density | 2.300±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Acetone |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C7H5Br3O2S/c8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-5H |
| InChIKey | DWWMSEANWMWMCB-UHFFFAOYSA-N |
| SMILES | C1(S(C(Br)(Br)Br)(=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 17025-47-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, [(tribromomethyl)sulfonyl]- (17025-47-7) |
Description and Uses
The derivatives of phenyl tribromomethyl sulfone as novel compounds with potential pesticidal activity
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2930.90.2900 |
