A7787212
Tridecafluorohexane-1-sulfonic acid potassium salt , 95% , 3871-99-6
Synonym(s):
Perfluorohexanesulfonic acid potassium salt;Potassium tridecafluoro-1-hexanesulfonate
CAS NO.:3871-99-6
Empirical Formula: C6F13KO3S
Molecular Weight: 438.2
MDL number: MFCD00066406
EINECS: 223-393-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5g | RMB214.40 | In Stock |
|
| 10G | RMB347.20 | In Stock |
|
| 50G | RMB1310.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly) |
| form | Solid |
| color | White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6HF13O3S.K/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22;/h(H,20,21,22);/q;+1/p-1 |
| InChIKey | RSCGQEBKFSGWJT-UHFFFAOYSA-M |
| SMILES | C(F)(F)(C(F)(F)C(F)(F)S([O-])(=O)=O)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| EPA Substance Registry System | 1-Hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, potassium salt (3871-99-6) |
Description and Uses
Tridecafluorohexanesulfonic Acid is a perfluorinated compound that has been identified to be a p-glycoprotein (p-gp) inhibitor and therefore, a chemosensitizer. Tridecafluorohexanesulfonic Acid is part of a new class of global environmental pollutant; they bioaccumulate and are persistent in the environment and wildlife.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372-H411 |
| Precautionary statements | P260-P263-P273-P301+P312-P304+P340+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HS Code | 29033990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Lact. Repr. 1B STOT RE 1 |









