A7789312
2-(Trifluoromethyl)pyridine-4-carboxylic acid , 97% , 131747-41-6
Synonym(s):
2-(Trifluoromethyl)isonicotinic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 500MG | RMB59.20 | In Stock |
|
| 1G | RMB81.60 | In Stock |
|
| 5g | RMB300.00 | In Stock |
|
| 25g | RMB1272.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-223℃ |
| Boiling point: | 338.9±42.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| pka | 2.94±0.10(Predicted) |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-3-4(6(12)13)1-2-11-5/h1-3H,(H,12,13) |
| InChIKey | BZFGKBQHQJVAHS-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 131747-41-6(CAS DataBase Reference) |
Description and Uses
2-(Trifluoromethyl)isonicotinic Acid is useful reactant for the preparation of RAF709 as selective RAF inhibitor targeting RAS mutant cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |






