A7797712
Tetrapropylammonium hydroxide solution , ~50%inH2O(cosolvent:~20%methanol) , 4499-86-9
Synonym(s):
TPAOH solution
CAS NO.:4499-86-9
Empirical Formula: C12H29NO
Molecular Weight: 203.37
MDL number: MFCD00009360
EINECS: 224-800-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB165.60 | In Stock |
|
| 100G | RMB493.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100-102 °C |
| Density | 1.00 g/mL at 20 °C |
| refractive index | n |
| Flash point: | 102°C |
| storage temp. | Store below +30°C. |
| solubility | Miscible with strong electrolytes. |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 1.012 |
| PH Range | 14 |
| PH | >7 (H2O, 20°C) (undiluted) |
| Water Solubility | Miscible in water |
| Sensitive | Air Sensitive |
| BRN | 4207983 |
| InChI | 1S/C12H28N.H2O/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | LPSKDVINWQNWFE-UHFFFAOYSA-M |
| SMILES | [OH-].CCC[N+](CCC)(CCC)CCC |
| CAS DataBase Reference | 4499-86-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanaminium, N,N,N-tripropyl-, hydroxide (4499-86-9) |
Description and Uses
Tetra-n-propylammonium hydroxide is used as an intermediate, ion exchange agent, surface-active agent and solvent. Further, it is used as an antistatic agent, detergent sanitizers, softener for textiles and paper products, emulsifying agents and pigment dispersers. It finds application as curing accelerators. In addition to this, it acts as a phase transfer catalyst in organic synthesis to enhance the reaction rate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3267 8/PG 3 |
| WGK Germany | 3 |
| RTECS | BS8400000 |
| F | 4.4-10-34 |
| TSCA | TSCA listed |
| HS Code | 2923 90 00 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





