A7800312
1,3,5-Trifluoro-2-nitrobenzene , 96% , 315-14-0
Synonym(s):
1,3,5-Trifluoro-2-nitrobenzene
CAS NO.：315-14-0
Empirical Formula: C6H2F3NO2
Molecular Weight: 177.08
MDL number: MFCD00014687
EINECS: 206-248-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3.5 °C(lit.) |
| Boiling point: | 182-185 °C(lit.) |
| Density | 1.514 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 172 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Specific Gravity | 1.514 |
| BRN | 2106869 |
| InChI | InChI=1S/C6H2F3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| InChIKey | PWRFDGYYJWQIAB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1[N+]([O-])=O |
| CAS DataBase Reference | 315-14-0(CAS DataBase Reference) |
Description and Uses
2,4,6-Trifluoronitrobenzene has been used in preparation of 4-methoxy-2,6-difluoroanilines, versatile building blocks in medicinal chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
