A7801812
2,6,10-Trimethyl-2,6,10-triazaundecane , >95.0%(GC) , 3855-32-1
CAS NO.:3855-32-1
Empirical Formula: C11H27N3
Molecular Weight: 201.35
MDL number: MFCD00126936
EINECS: 223-362-3
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB74.40 | In Stock |
|
| 100ML | RMB198.40 | In Stock |
|
| 500ML | RMB958.40 | In Stock |
|
| 2.5l | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102 °C / 1mmHg |
| Density | 0,83 g/cm3 |
| vapor pressure | 2hPa at 10℃ |
| refractive index | 1.4450 to 1.4480 |
| Flash point: | 92°C |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 9.88±0.28(Predicted) |
| color | Colorless to Yellow to Green |
| Odor | Fishy odor |
| Water Solubility | 193.9g/L at 25℃ |
| InChI | InChI=1S/C11H27N3/c1-12(2)8-6-10-14(5)11-7-9-13(3)4/h6-11H2,1-5H3 |
| InChIKey | SKCNNQDRNPQEFU-UHFFFAOYSA-N |
| SMILES | C(N(CCCN(C)C)C)CCN(C)C |
| LogP | 0 at 25℃ |
| CAS DataBase Reference | 3855-32-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Propanediamine, N-[3-(dimethylamino)propyl]-N,N',N'-trimethyl- (3855-32-1) |
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H412-H302-H314-H311 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P361-P363-P405-P501-P273-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1760 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29212900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







