A7852112
2-Deoxy-2-fluoro-1,3,5-tri-O-benzoyl-α-D- arabinofuranose , ≥98.0%(HPLC) , 97614-43-2
CAS NO.：97614-43-2
Empirical Formula: C26H21FO7
Molecular Weight: 464.44
MDL number: MFCD00083339
EINECS: 619-281-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB396.00 | In Stock |
|
| 100g | RMB1519.20 | In Stock |
|
| 500g | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-77°C |
| Boiling point: | 584.1±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform or dichloromethane |
| form | Powder |
| color | White to Off-white |
| InChIKey | JOAHVPNLVYCSAN-PPTKZWKYSA-N |
| SMILES | [C@H]1(OC(=O)C2=CC=CC=C2)[C@H](F)[C@@H](OC(=O)C2C=CC=CC=2)O[C@@H]1COC(=O)C1C=CC=CC=1 |&1:0,10,12,23,r| |
| CAS DataBase Reference | 97614-43-2(CAS DataBase Reference) |
Description and Uses
Clofarabine intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29329990 |
