A7854112
Triethyl 2-fluoro-2-phosphonoacetate , ≥96% , 2356-16-3
Synonym(s):
2-Fluoro-2-phosphonoacetic acid triethyl ester;Diethyl [(ethoxycarbonyl)fluoromethyl]phosphonate;Ethyl diethylphosphonofluoroacetate
CAS NO.:2356-16-3
Empirical Formula: C8H16FO5P
Molecular Weight: 242.18
MDL number: MFCD00134400
EINECS: 627-648-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB45.60 | In Stock |
|
| 5G | RMB144.80 | In Stock |
|
| 25G | RMB555.20 | In Stock |
|
| 100G | RMB1552.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 75 °C0.01 mm Hg(lit.) |
| Density | 1.194 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.194 |
| BRN | 1912161 |
| InChI | InChI=1S/C8H16FO5P/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3/h7H,4-6H2,1-3H3 |
| InChIKey | FVPISMANESAJQZ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(P(OCC)(OCC)=O)F |
| CAS DataBase Reference | 2356-16-3(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Diels-Alder reactions
- Biosynthesis of terpene
- Stereoselective synthesis of unsaturated esters, fluorides and nitriles from the reactions of aldehydes and ketones using Wadsworth-Emmons phosphonates
- Synthesis of quinolones
- Horner-Wadsworth-Emmons asymmetric hydration
- Addition reactions and the subsequent application to click chemistry
- Asymmetric intermolecular Stetter reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P210e-P280a-P405-P501a |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, FLAMMABLE |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





