A7872112
Thioisonicotinamide , 97% , 2196-13-6
Synonym(s):
4-Pyridylthioamide;Pyridine-4-carbothioamide;Thioisonicotinamide
CAS NO.：2196-13-6
Empirical Formula: C6H6N2S
Molecular Weight: 138.19
MDL number: MFCD00006437
EINECS: 218-592-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB283.20 | In Stock |
|
| 100g | RMB893.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199 °C (D) |
| Boiling point: | 279℃ |
| Density | 1.265 |
| refractive index | 1.5300 (estimate) |
| Flash point: | 123℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Methanol; Ethyl Acetate |
| pka | 11.70±0.29(Predicted) |
| form | Crystalline Powder |
| color | Cream to beige to yellow-brown |
| BRN | 2174 |
| InChI | InChI=1S/C6H6N2S/c7-6(9)5-1-3-8-4-2-5/h1-4H,(H2,7,9) |
| InChIKey | KPIIGXWUNXGGCP-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C(N)=S)=C1 |
| CAS DataBase Reference | 2196-13-6(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Pyridinecarbothioamide (2196-13-6) |
Description and Uses
Thioisonicotinamide is an Impurity of Ethionamide (E890420) with tuberculostatic activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-42/43-36/37/38-22 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| RTECS | US4204000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
