A7872512
2',3',4'-Trihydroxyacetophenone , >98.0%(HPLC)(T) , 528-21-2
Synonym(s):
2′,3′,4′-Trihydroxyacetophenone
CAS NO.:528-21-2
Empirical Formula: C8H8O4
Molecular Weight: 168.15
MDL number: MFCD00002193
EINECS: 208-430-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB100.80 | In Stock |
|
| 25G | RMB405.60 | In Stock |
|
| 100g | RMB1062.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-172 °C(lit.) |
| Boiling point: | 257.07°C (rough estimate) |
| Density | 1.3037 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 7.81±0.23(Predicted) |
| color | White to Orange to Green |
| Merck | 14,4342 |
| InChI | InChI=1S/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 |
| InChIKey | XIROXSOOOAZHLL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1O)C |
| CAS DataBase Reference | 528-21-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(2,3,4-trihydroxyphenyl)-(528-21-2) |
| EPA Substance Registry System | Ethanone, 1-(2,3,4-trihydroxyphenyl)- (528-21-2) |
Description and Uses
2,3,4-Trihydroxyacetophenone is used as a reagent in the synthesis of chromenone and quinolinone derivatives as potent antioxidant agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | AN0527000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |







