A7874312
1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane , >98.0%(GC) , 56-33-7
CAS NO.：56-33-7
Empirical Formula: C16H22OSi2
Molecular Weight: 286.52
MDL number: MFCD00039793
EINECS: 200-265-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB349.60 | In Stock |
|
| 100g | RMB1094.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -89°C |
| Boiling point: | 155 °C |
| Density | 0.976 |
| refractive index | 1.52 |
| Flash point: | 156°C |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 0.976 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| λmax | 259nm(Cyclohexane)(lit.) |
| InChI | InChI=1S/C16H22OSi2/c1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | YQJPWWLJDNCSCN-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C1=CC=CC=C1)O[Si](C)(C)C1=CC=CC=C1 |
| CAS DataBase Reference | 56-33-7(CAS DataBase Reference) |
| EPA Substance Registry System | Disiloxane, 1,1,3,3-tetramethyl-1,3-diphenyl- (56-33-7) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| RTECS | JM9236000 |
| TSCA | Yes |
| HS Code | 29319090 |
