A7880412
Tetrafluorophthalonitrile , >98.0%(GC) , 1835-65-0
Synonym(s):
1,2-Dicyano-3,4,5,6-tetrafluorobenzene;3,4,5,6-Tetrafluoro-1,2-benzenedicarbonitrile
CAS NO.:1835-65-0
Empirical Formula: C8F4N2
Molecular Weight: 200.09
MDL number: MFCD00001774
EINECS: 217-400-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB192.80 | In Stock |
|
| 100G | RMB630.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-86 °C(lit.) |
| Boiling point: | 274.2±40.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol,Acetone,Ethanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8F4N2/c9-5-3(1-13)4(2-14)6(10)8(12)7(5)11 |
| InChIKey | OFLRJMBSWDXSPG-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(F)C(F)=C(F)C(F)=C1C#N |
| CAS DataBase Reference | 1835-65-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrafluorophthalonitrile(1835-65-0) |
| EPA Substance Registry System | Tetrafluorophthalonitrile (1835-65-0) |
Description and Uses
Tetrafluorophthalonitrile was used in the synthesis of dichloro-subphthalocyanine dimers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Lachrymator |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






