A7967612
Tetrafluorophthalic Acid , >98.0%(T) , 652-03-9
Synonym(s):
o -Tetrafluorobenzenedicarboxylic acid;3,4,5,6-Tetrafluoro-1,2-benzenedicarboxylic acid;3,4,5,6-Tetrafluorophthalic acid
CAS NO.:652-03-9
Empirical Formula: C8H2F4O4
Molecular Weight: 238.09
MDL number: MFCD00002407
EINECS: 211-483-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB107.20 | In Stock |
|
| 100g | RMB368.80 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-154 °C(lit.) |
| Boiling point: | 345.7±42.0 °C(Predicted) |
| Density | 1.6239 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 1.28±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 2057012 |
| InChI | InChI=1S/C8H2F4O4/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11/h(H,13,14)(H,15,16) |
| InChIKey | YJLVXRPNNDKMMO-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C(F)C(F)=C(F)C(F)=C1C(O)=O |
| CAS DataBase Reference | 652-03-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrafluorophthalic acid(652-03-9) |
Description and Uses
Tetrafluorophthalic Acid, can be used as a starting material in the synthesis of various chemical compounds such as Perfluoroanthracene (P227605), a perfluorinated graded index polymer optical fiber (PFGI-POF) component.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29173990 |







