A7884512
2,4,5-Triamino-6-hydroxypyrimidine Sulfate , >90.0%(T) , 35011-47-3
Synonym(s):
2,4,5-Triamino-6-hydroxypyrimidine sulfate
CAS NO.:35011-47-3
Empirical Formula: C4H9N5O5S
Molecular Weight: 239.21
MDL number: MFCD00150093
EINECS: 609-054-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB124.80 | In Stock |
|
| 250g | RMB223.20 | In Stock |
|
| 500G | RMB433.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| RTECS | UW7175000 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO. |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C4H7N5O.H2O4S/c5-1-2(6)8-4(7)9-3(1)10;1-5(2,3)4/h5H2,(H5,6,7,8,9,10);(H2,1,2,3,4) |
| InChIKey | RSKNEEODWFLVFF-UHFFFAOYSA-N |
| SMILES | NC1C(N=C(N)NC=1N)=O.S(O)(O)(=O)=O |
| CAS DataBase Reference | 35011-47-3(CAS DataBase Reference) |
Description and Uses
2,4,5-Triamino-6-hydroxypyrimidine sulfate is used in the preparation of guanines and other purine derivatives with antiviral activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29349990 |







