A7889412
Tetrakis(trimethylsilyl)silane , >98.0%(GC) , 4098-98-0
Synonym(s):
2,2-Bis(trimethylsilyl)-1,1,1,3,3,3-hexamethyl-trisilane
| Pack Size | Price | Stock | Quantity |
| 1G | RMB314.40 | In Stock |
|
| 5G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C (lit.)
≥300 °C |
| Boiling point: | 267°C |
| Density | 0.791±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | off-white |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1860786 |
| InChI | 1S/C12H36Si5/c1-13(2,3)17(14(4,5)6,15(7,8)9)16(10,11)12/h1-12H3 |
| InChIKey | BOJSDHZZKKYWAS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| CAS DataBase Reference | 4098-98-0(CAS DataBase Reference) |
Description and Uses
It is used as a starting material for the synthesis of tris(trimethylsilyl)silyl lithium with methyl lithium and in the preparation of lithium bis[(TMS)3silyl]cuprate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2931.90.9010 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
