F483029
Tris(trimethylsilyl)silane , 97 , 1873-77-4
Synonym(s):
1,1,1,3,3,3-Hexamethyl-2-trimethylsilyl-trisilane;TTMSS
CAS NO.:1873-77-4
Empirical Formula: C9H28Si4
Molecular Weight: 248.66
MDL number: MFCD00077893
EINECS: 678-629-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB344.80 | In Stock |
|
| 5g | RMB1104.80 | In Stock |
|
| 25g | RMB4350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73 °C/5 mmHg (lit.) |
| Density | 0.806 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 55 °C |
| storage temp. | Flammables area |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 0.806 |
| Water Solubility | Miscible with pentane, ether, toluene and tetrahydrofuran. Sparingly miscible with acetone and acetonitrile. Immiscible with water. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Light Sensitive |
| Merck | 14,9757 |
| BRN | 1923953 |
| InChI | InChI=1S/C9H28Si4/c1-11(2,3)10(12(4,5)6)13(7,8)9/h10H,1-9H3 |
| InChIKey | SQMFULTZZQBFBM-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)[SiH]([Si](C)(C)C)[Si](C)(C)C |
| CAS DataBase Reference | 1873-77-4(CAS DataBase Reference) |
Description and Uses
Tris(trimethylsilyl)silane) is used in the synthesis of silated alkenes and alkynes. Also used in the preparation of fused quinolines.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




