A7896512
Tridecafluorohexyl Bromide , >97.0%(GC) , 335-56-8
Synonym(s):
1-Bromotridecafluorohexane
CAS NO.:335-56-8
Empirical Formula: C6BrF13
Molecular Weight: 398.95
MDL number: MFCD00042349
EINECS: 206-391-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB41.60 | In Stock |
|
| 5G | RMB133.60 | In Stock |
|
| 25G | RMB437.60 | In Stock |
|
| 100G | RMB1263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -49℃ |
| Boiling point: | 97 °C(lit.) |
| Density | 1.871 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 100-101°C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.871 |
| BRN | 1714896 |
| InChI | InChI=1S/C6BrF13/c7-5(16,17)3(12,13)1(8,9)2(10,11)4(14,15)6(18,19)20 |
| InChIKey | JTYRBFORUCBNHJ-UHFFFAOYSA-N |
| SMILES | C(Br)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 335-56-8(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorohexylbromide (335-56-8) |
Description and Uses
Employed in the preparation of perfluorononanal by hydroformylation.1,2
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29037800 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






