A7908112
5-<i>tert</i>-Butyl-<i>m</i>-xylene , >98.0%(GC) , 98-19-1
Synonym(s):
1-tert-Butyl-3,5-dimethylbenzene;5-tert-Butyl-m-xylene;5-tert-Butyl-m-xylene;sym.-tert-Butyl-m-xylene
CAS NO.：98-19-1
Empirical Formula: C12H18
Molecular Weight: 162.27
MDL number: MFCD00008832
EINECS: 202-647-6
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB47.20 | In Stock |
|
| 100ml | RMB116.00 | In Stock |
|
| 500ML | RMB378.40 | In Stock |
|
| 2.5L | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -18 °C |
| Boiling point: | 205-206 °C(lit.) |
| Density | 0.867 g/mL at 25 °C(lit.) |
| vapor pressure | 0.4 hPa (20 °C) |
| refractive index | n |
| Flash point: | 162 °F |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| PH | 7 (H2O, 20℃) |
| BRN | 1853314 |
| InChI | InChI=1S/C12H18/c1-9-6-10(2)8-11(7-9)12(3,4)5/h6-8H,1-5H3 |
| InChIKey | FZSPYHREEHYLCB-UHFFFAOYSA-N |
| SMILES | C1(C(C)(C)C)=CC(C)=CC(C)=C1 |
| CAS DataBase Reference | 98-19-1(CAS DataBase Reference) |
| EPA Substance Registry System | 5-tert-Butyl-m-xylene (98-19-1) |
Description and Uses
1-tert-Butyl-3,5-dimethylbenzene has been used in the synthesis of bulky, multi-alkylated diaryl disulfides such as bis(4-tert-butyl-2,6-dimethylphenyl) disulfide and bis(2,4,6-triisopropylphenyl) disulfide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H227-H315-H319 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | ZE3900000 |
| Autoignition Temperature | 560 °C DIN 51794 |
| TSCA | Yes |
| HS Code | 2902 90 00 |
