A7911712
Tris(2,4-pentanedionato)chromium(III) , >97.0% , 21679-31-2
Synonym(s):
Chromium(III) 2,4-pentanedionate;Chromium(III) acetylacetonate;Cr(acac)3;Tris(acetylacetonato)chromium(III), Tris(2,4-pentanedionato)chromium(III)
CAS NO.:21679-31-2
Empirical Formula: C15H21CrO6
Molecular Weight: 349.32
MDL number: MFCD00000015
EINECS: 244-526-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB120.00 | In Stock |
|
| 250g | RMB207.20 | In Stock |
|
| 500G | RMB379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C(lit.) |
| Boiling point: | 340 °C(lit.) |
| Density | 1,35 g/cm3 |
| bulk density | 450kg/m3 |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | >200°C |
| storage temp. | Store below +30°C. |
| solubility | 11g/l |
| form | Crystalline Powder, Crystals, and/or Chunks |
| Specific Gravity | 1.35 |
| color | Purple to maroon |
| PH | 6 (1g/l, H2O, 20℃) |
| Water Solubility | 11 g/L (20 ºC) |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 4148971 |
| Exposure limits | NIOSH: IDLH 25 mg/m3; TWA 0.5 mg/m3 |
| InChI | 1S/3C5H8O2.Cr/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | JWORPXLMBPOPPU-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[Cr](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | 0.4 at 20℃ |
| NIST Chemistry Reference | Chromium, tris(2,4-pentanedionato-o,o')-(21679-31-2) |
| EPA Substance Registry System | Chromium(III) acetylacetonate (21679-31-2) |
Description and Uses
Catalyst in the oxidation of methacrylic esters by hydrogen peroxide, MOCVDChromium(III) 2,4-pentanedionate is used in the reduction of detonation of nitromethane. It is also used in NMR spectroscopy as a relaxation agent due to its solubility in nonpolar organic solvents and its paramagnetism. Further, it is involved in the modification of the surface properties of solid polyurethanes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-36-37/39 |
| WGK Germany | 2 |
| RTECS | GB7575000 |
| TSCA | TSCA listed |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | LD50 orally in Rabbit: 3360 mg/kg LD50 dermal Rabbit 6350 mg/kg |






