A7916912
2-(Trifluoromethyl)benzenesulfonamide , ≥98.0% , 1869-24-5
CAS NO.:1869-24-5
Empirical Formula: C7H6F3NO2S
Molecular Weight: 225.19
MDL number: MFCD00042420
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB40.00 | In Stock |
|
| 10g | RMB124.80 | In Stock |
|
| 25G | RMB196.80 | In Stock |
|
| 100g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-184 °C(lit.) |
| Boiling point: | 320.5±52.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 9.55±0.60(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2697078 |
| InChI | 1S/C7H6F3NO2S/c8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-4H,(H2,11,12,13) |
| InChIKey | AFFPZJFLSDVZBV-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccccc1C(F)(F)F |
| CAS DataBase Reference | 1869-24-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 22 |
| Safety Statements | 22-24/25-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | I |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |






