PRODUCT Properties
| Melting point: | -66 °C |
| Boiling point: | 215 °C (lit.) |
| Density | 0.862 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 178 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Insoluble in water. Soluble in alcohol, ether. |
| BRN | 2039481 |
| InChI | InChI=1S/C12H18/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | WJYMPXJVHNDZHD-UHFFFAOYSA-N |
| SMILES | C1(CC)=CC(CC)=CC(CC)=C1 |
| CAS DataBase Reference | 102-25-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,3,5-triethyl- (102-25-0) |
Description and Uses
1,3,5-Triethylbenzene was used as a supramoelcular template to organize molecular-recognition elements. It was also used to synthesize a series of di- and trinucleating ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H413 |
| Precautionary statements | P264-P273-P280-P302+P352-P305+P351+P338-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2902.90.9000 |
| HazardClass | 9 |
| PackingGroup | III |
