A7927312
1,3,5-Triacetylbenzene , >98.0%(GC) , 779-90-8
CAS NO.：779-90-8
Empirical Formula: C12H12O3
Molecular Weight: 204.22
MDL number: MFCD00008741
EINECS: 212-302-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB191.20 | In Stock |
|
| 5G | RMB497.60 | In Stock |
|
| 10g | RMB984.80 | In Stock |
|
| 25G | RMB2438.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-162°C |
| Boiling point: | 302.71°C (rough estimate) |
| Density | 1.1554 (rough estimate) |
| refractive index | 1.5205 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Practically insoluble in water |
| form | powder to crystal |
| color | White to Yellow to Green |
| InChI | InChI=1S/C12H12O3/c1-7(13)10-4-11(8(2)14)6-12(5-10)9(3)15/h4-6H,1-3H3 |
| InChIKey | HSOAIPRTHLEQFI-UHFFFAOYSA-N |
| SMILES | C1(C(=O)C)=CC(C(=O)C)=CC(C(=O)C)=C1 |
| CAS DataBase Reference | 779-90-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29093090 |
