A7927512
2,4,4'-Trihydroxybenzophenone , 98% , 1470-79-7
CAS NO.:1470-79-7
Empirical Formula: C13H10O4
Molecular Weight: 230.22
MDL number: MFCD00002356
EINECS: 216-004-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB129.60 | In Stock |
|
| 5g | RMB399.20 | In Stock |
|
| 10G | RMB719.20 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-198 °C(lit.) |
| Boiling point: | 332.2°C (rough estimate) |
| Density | 1.2683 (rough estimate) |
| refractive index | 1.4977 (estimate) |
| storage temp. | RT, stored under nitrogen |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| pka | 7.59±0.35(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | 1S/C13H10O4/c14-9-3-1-8(2-4-9)13(17)11-6-5-10(15)7-12(11)16/h1-7,14-16H |
| InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(=O)c2ccc(O)cc2O |
| CAS DataBase Reference | 1470-79-7(CAS DataBase Reference) |
Description and Uses
2,4,4''-Trihydroxybenzophenone is a small molecule inhibitor of viral replication.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 2914.50.3000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







