A7934112
Tetraamylammonium Iodide , >98.0%(T) , 2498-20-6
Synonym(s):
Tetrapentylammonium iodide
CAS NO.:2498-20-6
Empirical Formula: C20H44IN
Molecular Weight: 425.47
MDL number: MFCD00041980
EINECS: 219-688-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB162.40 | In Stock |
|
| 25G | RMB712.80 | In Stock |
|
| 100g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-137 °C |
| storage temp. | Store below +30°C. |
| solubility | 7.40g/l |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 7.40g/L |
| Sensitive | Light Sensitive |
| BRN | 3917412 |
| InChI | 1S/C20H44N.HI/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FBLZDUAOBOMSNZ-UHFFFAOYSA-M |
| SMILES | [I-].[N+](CCCCC)(CCCCC)(CCCCC)CCCCC |
| CAS DataBase Reference | 2498-20-6(CAS DataBase Reference) |
| EPA Substance Registry System | Tetrapentylammonium iodide (2498-20-6) |
Description and Uses
Tetraamylammonium Iodide is is a quaternary ammonium based antimicrobial used as a bacteriostat, deodorant, disinfectant and(or) a microbiocide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 2923.90.0100 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






