A7941512
Trimethoxy[3-(phenylamino)propyl]silane , >98.0%(T) , 3068-76-6
Synonym(s):
(3-Anilinopropyl)trimethoxysilane;[3-(Phenylamino)propyl]trimethoxysilane;N-[3-(Trimethoxysilyl)propyl]aniline;Trimethoxy[3-(phenylamino)propyl]silane
CAS NO.:3068-76-6
Empirical Formula: C12H21NO3Si
Molecular Weight: 255.39
MDL number: MFCD00053673
EINECS: 221-328-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB123.20 | In Stock |
|
| 500G | RMB513.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 310 °C(lit.) |
| Density | 1.07 g/mL at 25 °C(lit.) |
| vapor pressure | 0-0.042Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, protect from light |
| pka | 5.02±0.50(Predicted) |
| form | liquid |
| Specific Gravity | 1.07 |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 993-1000000mg/L at 20℃ |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8620045 |
| InChI | 1S/C12H21NO3Si/c1-14-17(15-2,16-3)11-7-10-13-12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3 |
| InChIKey | KBJFYLLAMSZSOG-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCNc1ccccc1)(OC)OC |
| LogP | -0.6-2.5 |
| CAS DataBase Reference | 3068-76-6(CAS DataBase Reference) |
| EPA Substance Registry System | N-[3-(Trimethoxysilyl)propyl]aniline (3068-76-6) |
Description and Uses
TMSPA is a monomer which can be polymerized to form poly(TMPSA). Poly(TMPSA) can be used to coat gold nanorods (AuNRs) to fabricate an electrode for the sensing of hydrogen peroxide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H317-H341-H351-H372-H412 |
| Precautionary statements | P202-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Blood |
| Hazard Codes | C |
| Risk Statements | 34-40-48/20/21/22-52/53-68-43 |
| Safety Statements | 26-36/37/39-45-35 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 2 Eye Dam. 1 Muta. 2 Skin Corr. 1B Skin Sens. 1 STOT RE 1 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |

![Trimethoxy[3-(phenylamino)propyl]silane](https://img.chemicalbook.com/CAS/GIF/3068-76-6.gif)



![(2-(7-Oxabicyclo[4.1.0]heptan-3-yl)ethyl)triethoxysilane](https://img.chemicalbook.com/CAS/GIF/10217-34-2.gif)



