PRODUCT Properties
| Melting point: | 109 °C |
| Boiling point: | 240℃ |
| Density | 1.536 |
| Flash point: | 99℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.59±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H3F3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) |
| InChIKey | CPZROMDDCPPFOO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC(F)=C1F |
| CAS DataBase Reference | 654-87-5(CAS DataBase Reference) |
Description and Uses
2,3,5-Trifluorobenzoic acid can be used as an intermediate for fluorine-containing pharmaceuticals, in the synthesis of quinolone antibacterial drugs, antiviral drugs, antitumor small molecules, and central nervous system drugs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2916310090 |






