A7968612
2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane , >97.0%(GC) , 2554-06-5
Synonym(s):
2,4,6,8-Tetraethenyl-2,4,6,8-tetramethylcyclotetrasiloxane
CAS NO.：2554-06-5
Empirical Formula: C12H24O4Si4
Molecular Weight: 344.66
MDL number: MFCD00040293
EINECS: 219-863-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB100.80 | In Stock |
|
| 250g | RMB248.80 | In Stock |
|
| 500G | RMB494.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −44 °C (dec.)(lit.) |
| Boiling point: | 111-112 °C10 mm Hg(lit.) |
| Density | 0.997 g/mL at 25 °C(lit.) |
| vapor pressure | 93.5Pa at 25℃ |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Miscible with most organic solvents. |
| form | liquid |
| Specific Gravity | 0.998 |
| color | Colorless to Almost colorless |
| Water Solubility | 7μg/L at 23℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 1807272 |
| InChI | 1S/C12H24O4Si4/c1-9-17(5)13-18(6,10-2)15-20(8,12-4)16-19(7,11-3)14-17/h9-12H,1-4H2,5-8H3 |
| InChIKey | VMAWODUEPLAHOE-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](C)(O[Si](C)(O[Si](C)(O1)C=C)C=C)C=C)C=C |
| LogP | 6.47 |
| CAS DataBase Reference | 2554-06-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4,6,8-Tetravinyl-2,4,6,8-tetramethylcyclotetrasiloxane(2554-06-5) |
| EPA Substance Registry System | Cyclotetrasiloxane, 2,4,6,8-tetraethenyl-2,4,6,8-tetramethyl- (2554-06-5) |
Description and Uses
2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is used as an intermediate in organic synthesis. It is used in the preparation of 4-vinyl-benzoic acid ethyl ester. Further, it is used to prepare styrene derivatives by cross-coupling with aryl bromide in the presence of palladium catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | GZ4550000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
