A7995312
1,3,4,6-Tetra-<i>O</i>-acetyl-β-<small>D</small>-mannopyranose , ≥97.0% , 18968-05-3
Synonym(s):
β-D -Mannopyranose 1,3,4,6-tetra-O-acetate
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB217.60 | In Stock |
|
| 1G | RMB599.20 | In Stock |
|
| 5G | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-161 °C(lit.) |
| Boiling point: | 425.5±45.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| refractive index | -22.5 ° (C=1.4, CHCl3) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | very faint turbidity in Chloroform |
| form | powder to crystal |
| pka | 12.22±0.70(Predicted) |
| color | White to Almost white |
| optical activity | [α]19/D 68°, c = 0.7 in pyridine |
| BRN | 96634 |
| InChI | InChI=1/C14H20O10/c1-6(15)20-5-10-12(21-7(2)16)13(22-8(3)17)11(19)14(24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11+,12-,13-,14-/s3 |
| InChIKey | SHBHJRVMGYVXKK-XVIXHAIJSA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@@H](COC(=O)C)O[C@@H](OC(=O)C)[C@@H](O)[C@H]1OC(=O)C |&1:0,5,12,17,19,r| |
| CAS DataBase Reference | 18968-05-3(CAS DataBase Reference) |
Description and Uses
1,3,4,6-Tetra-o-acetyl-beta-d-mannopyranose is an intermediate in the preparation of precursors of 2-[18F]fluoro-2-deoxy-D-glucose for diagnostic use in positron emission tomography.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
