Topotecan hydrochloride hydrate , 98%(HPLC) , 123948-87-8
Synonym(s):
9-[(dimethylamino)methyl]-10-hydroxy-(20S)-camptothecin hydrochloride hydrate;hycamptamine hydrochloride hydrate;Hydrogen chloride solution;NSC-609669 hydrochloride hydrate;SKF-104864A hydrochloride hydrate
CAS NO.:123948-87-8
Empirical Formula: C23H23N3O5
Molecular Weight: 421.45
MDL number: MFCD00866235
EINECS: 687-471-1
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB371.20 | In Stock |
|
| 50MG | RMB1230.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | −114 °C(lit.) |
| Boiling point: | >100 °C(lit.) |
| Density | 1.2 g/mL at 25 °C(lit.) |
| vapor density | 1.3 (vs air) |
| vapor pressure | 613 psi ( 21.1 °C) |
| Flash point: | 12 °C |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | H2O: soluble |
| form | liquid |
| pka | 8.92±0.40(Predicted) |
| color | yellow |
| InChI | InChI=1S/C23H23N3O5/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20/h5-8,27,30H,4,9-11H2,1-3H3/t23-/m0/s1 |
| InChIKey | UCFGDBYHRUNTLO-QHCPKHFHSA-N |
| SMILES | N1C2C(=C(CN(C)C)C(O)=CC=2)C=C2CN3C(C=12)=CC1[C@](CC)(O)C(=O)OCC=1C3=O |
| CAS DataBase Reference | 123948-87-8(CAS DataBase Reference) |
Description and Uses
Topotecan was launched in the US for the second-line treatment of ovarian cancer. It can be prepared in four steps from camptothecin and is a water soluble derivative of the natural product with decreased toxicity. Unlike its chemical relative irinotecan, topotecacan in not a prodrug and does not require bioactivation. It is an inhibitor of topoisomerase I. Specifically, it inhibits the release of topoisomerase I from DNA, where it relaxes supercoiled DNA, giving rise to single-strand breaks. When the replication fork reaches this complex, double-stand breaks can occur. This signals apoptosis and eventually gives rise to cell death. Evidence indicates hycamtin is safe for people with impaired hepatic function.
antineoplastic;DNA topoisomerase type 1 inhibitor
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H361d |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | T,C,F,Xi |
| Risk Statements | 36/37/38-67-35-20-11-34-48-46-36 |
| Safety Statements | 26-45-36/37/39-37/39-36-22-24/25-16-7 |
| RIDADR | UN 3286 3/PG 2 |
| WGK Germany | 2 |
| RTECS | MW4025000 |
| F | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Hazardous Substances Data | 123948-87-8(Hazardous Substances Data) |





