A8029412
2,3,4-<WBR>Trifluorobenzenesulfonyl chloride , 97% , 175278-08-7
CAS NO.：175278-08-7
Empirical Formula: C6H2ClF3O2S
Molecular Weight: 230.59
MDL number: MFCD00102573
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.32 | In Stock |
|
| 5g | RMB163.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-124 °C |
| Boiling point: | 234-236 °C(lit.) |
| Density | 1.640 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 225 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | liquid |
| color | Clear, faint yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C6H2ClF3O2S/c7-13(11,12)4-2-1-3(8)5(9)6(4)10/h1-2H |
| InChIKey | XFTDZYFHXRZLEF-UHFFFAOYSA-N |
| SMILES | Fc1ccc(c(F)c1F)S(Cl)(=O)=O |
| CAS DataBase Reference | 175278-08-7(CAS DataBase Reference) |
Description and Uses
2,3,4-Trifluorobenzenesulfonyl chloride may be used as an arylating agent during the synthesis of (2,3,4-trifluorophenyl)furan derivatives. It may also be employed during the preparation of 1-(2-bromobenzyl)-2,5-bis(2,3,4-trifluorophenyl)pyrrole and 1-(2-bromobenzyl)-2-(2,3,4-trifluorophenyl)pyrrole.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
