A8030012
Titanium diisopropoxide bis(acetylacetonate) , 75wt.%inisopropanol , 17927-72-9
Synonym(s):
Diisopropoxytitanium bis(acetylacetonate) solution;Ti(acac)2OiPr2;TYZOR AA organic titanate
CAS NO.:17927-72-9
Empirical Formula: C16H28O6Ti
Molecular Weight: 364.26
MDL number: MFCD00000031
EINECS: 241-866-1
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB23.20 | In Stock |
|
| 100ML | RMB44.80 | In Stock |
|
| 500ML | RMB153.60 | In Stock |
|
| 2.5L | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85°C |
| Density | 1.00 g/mL at 20 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point: | 54 °F |
| storage temp. | 2-30°C |
| pka | 0[at 20 ℃] |
| form | Liquid |
| Specific Gravity | 1.01 |
| color | Brown |
| Water Solubility | Hydrolyze with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/2C5H8O2.2C3H7O.Ti/c2*1-4(6)3-5(2)7;2*1-3(2)4;/h2*3,6H,1-2H3;2*3H,1-2H3;/q;;2*-1;+4/p-2/b2*4-3+;;; |
| InChIKey | OVSGBKZKXUMMHS-VVDZMTNVSA-L |
| SMILES | CC(C)O[Ti](OC(C)C)(O\C(C)=C\C(C)=O)O\C(C)=C\C(C)=O |
| LogP | 0.742 at 23℃ |
| EPA Substance Registry System | Titanium, bis(2,4-pentanedionato-.kappa.O,.kappa.O')bis(2-propanolato)- (17927-72-9) |
Description and Uses
Titanium(diisopropoxide) bis(2,4-pentanedionate) is used as catalyst, used in sol-gel, coating, primer and crosslinking.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H318-H336 |
| Precautionary statements | P210-P233-P240-P241-P280-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi,T |
| Risk Statements | 11-36/37/38-67-20/21-41-39/23/24/25-37/38-20/21/22 |
| Safety Statements | 16-26-36/37/39-45-24/25 |
| RIDADR | UN 1987 3/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9051 |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 STOT SE 3 |
| REACH Registrations | Active |








