A8048612
Tetramethylammonium hexafluorophosphate , 98% , 558-32-7
CAS NO.:558-32-7
Empirical Formula: C4H12F6NP
Molecular Weight: 219.11
MDL number: MFCD00012012
EINECS: 209-194-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.80 | In Stock |
|
| 25G | RMB160.80 | In Stock |
|
| 100g | RMB614.40 | In Stock |
|
| 500g | RMB2028.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| refractive index | 1.482-1.485 |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | Powder |
| color | White |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 3730394 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. May decompose on exposure to water or moist air. |
| InChI | 1S/C4H12N.F6P/c1-5(2,3)4;1-7(2,3,4,5)6/h1-4H3;/q+1;-1 |
| InChIKey | ZFKULDQWLXAKIM-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.F[P-](F)(F)(F)(F)F |
| CAS DataBase Reference | 558-32-7(CAS DataBase Reference) |
Description and Uses
It finds its application in the oxidation of cytochrome c in nonaqueous solvents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BS8000000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





