A8325332
Aldicarb-sulfone , Analysis standard , 1646-88-4
CAS NO.:1646-88-4
Empirical Formula: C7H14N2O4S
Molecular Weight: 222.26
MDL number: MFCD00041804
EINECS: 216-710-0
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB295.20 | In Stock |
|
| 100MG | RMB1119.20 | In Stock |
|
| 500MG | RMB4079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C |
| Density | 1.3816 (rough estimate) |
| vapor pressure | 1.2×10-2 Pa (25 °C) |
| refractive index | 1.5690 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Water Solubility | 10 g l-1 (25 °C) |
| pka | 13.44±0.46(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 2215242 |
| Major Application | agriculture environmental |
| InChI | 1S/C7H14N2O4S/c1-7(2,14(4,11)12)5-9-13-6(10)8-3/h5H,1-4H3,(H,8,10) |
| InChIKey | YRRKLBAKDXSTNC-UHFFFAOYSA-N |
| SMILES | CNC(ON=CC(C)(C)S(C)(=O)=O)=O |
| EPA Substance Registry System | Aldicarb sulfone (1646-88-4) |
Description and Uses
Aldoxycarb, is also called 2-mesyl-2-methylpropionaldehyde O-methylcarbamoyloxime (IUPAC), the sulfone analog of aldicarb, is also a systemic insecticide effective for control of insects (mainly sucking insect pests such as aphids, leafhoppers, etc.).
Aldoxycarb is a soil applied systemic oxime carbamate insecticide effective for the control of insects (mainly sucking pests such as aphids, leafhoppers, etc.), mites and nematodes on many field (cotton, maize, etc.) and vegetable crops.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H400 |
| Precautionary statements | P260-P262-P273-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 24-26/28 |
| Safety Statements | 28-36/37-45 |
| RIDADR | 2757 |
| WGK Germany | 3 |
| RTECS | UE2080000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 |
| Toxicity | duck,LD50,oral,33500ug/kg (33.5mg/kg),Pesticide Manual. Vol. 9, Pg. 18, 1991. |







