A8327632
2-Amino-5-bromo-3-pyridinemethanol , 98% , 335031-01-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB53.28 | In Stock |
|
| 1g | RMB223.92 | In Stock |
|
| 5g | RMB389.60 | In Stock |
|
| 25G | RMB1671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-140°C |
| Boiling point: | 343.5±37.0 °C(Predicted) |
| Density | 1.766±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Acetone, Ethyl Acetate, Methanol |
| pka | 13.16±0.10(Predicted) |
| form | Solid |
| color | Off-white to yellow |
| InChI | InChI=1S/C6H7BrN2O/c7-5-1-4(3-10)6(8)9-2-5/h1-2,10H,3H2,(H2,8,9) |
| InChIKey | HIVQAWXDBPYNDU-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1CO |
| CAS DataBase Reference | 335031-01-1(CAS DataBase Reference) |
Description and Uses
2-Amino-5-bromo-3-(hydroxymethyl)pyridine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
