A8356012
                    Vitexin , Analysis of standard products, ≥98% , 3681-93-4
                            Synonym(s):
4′,5,7-Trihydroxyflavone 8-C-glucoside;8-C-Glucosylapigenin;Apigenin 8-C-glucoside;Orientoside
                            
                        
                CAS NO.:3681-93-4
Empirical Formula: C21H20O10
Molecular Weight: 432.38
MDL number: MFCD00017456
EINECS: 222-963-8
| Pack Size | Price | Stock | Quantity | 
| 20MG | RMB516.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 256-257°C | 
                                    
| Boiling point: | 767.7±60.0 °C(Predicted) | 
                                    
| Density | 1.686±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Inert atmosphere,Room Temperature | 
                                    
| solubility | DMSO (Slightly), Pyridine (Slightly) | 
                                    
| pka | 6.27±0.40(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Yellow | 
                                    
| BRN | 67796 | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChIKey | SGEWCQFRYRRZDC-VPRICQMDSA-N | 
                                    
| SMILES | C12OC(=CC(=O)C=1C(=CC(O)=C2[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O)O)C1=CC=C(O)C=C1 |&1:12,13,15,16,18,r| | 
                                    
| LogP | -0.014 (est) | 
                                    
Description and Uses
Vitexin is a phenolic glycoside drug that shows anti-stress activity. It also shows possible application as an anti-diabetic.
Safety
| WGK Germany | 3 | 
| RTECS | DJ2984000 | 
| F | 10-21 | 
| HS Code | 29389090 | 




