A8364912
Valnemulin HCl , ≥95% , 133868-46-9
CAS NO.:133868-46-9
Empirical Formula: C31H53ClN2O5S
Molecular Weight: 601.28
MDL number: MFCD08458958
EINECS: 685-606-9
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB159.20 | In Stock |
|
| 250MG | RMB559.20 | In Stock |
|
| 5G | RMB2303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,9911 |
| InChIKey | MFBPRQKHDIVLOJ-AFFLPQGKSA-N |
| SMILES | C[C@H]1[C@@H]([C@](C[C@@H](OC(=O)CSC(C)(C)CNC(=O)[C@H](N)C(C)C)C2([C@H](C)CCC31CCC(=O)[C@]32[H])C)(C)C=C)O.Cl |&1:1,2,3,5,18,24,33,r| |
Description and Uses
Hydrochloride salt Valnemulin, semisynthetic antibiotic; derivative of pleuromutilin. Antibacterial.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H410-H319-H302-H400-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P273-P391-P501-P273-P391-P501-P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | 3 |
| HS Code | 2941.90.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







