A8366312
3-Vinylaniline , ≥97%, including KOH inhibitor , 15411-43-5
Synonym(s):
3-Aminostyrene
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB151.20 | In Stock |
|
| 1G | RMB448.80 | In Stock |
|
| 5G | RMB1647.20 | In Stock |
|
| 25G | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 212.46°C (rough estimate) |
| Density | 1.051 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 228 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.39±0.10(Predicted) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C8H9N/c1-2-7-4-3-5-8(9)6-7/h2-6H,1,9H2 |
| InChIKey | IFSSSYDVRQSDSG-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(C=C)=C1 |
Description and Uses
3-vinylaniline (3-VA) is a significant compound of aniline having a vinyl group and can be used for the production of fine chemicals, functionalized polymers, pigment and pharmaceuticals. Generally, 3-VA is produced by the selective hydrogenation reaction of 3-nitrostyrene (3-NS).
The formation of m-Vinylaniline from the reduction of m-Nitrostyrene containing an easily reducible vinyl-group using hydrazine hydrate as the reducing agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921420090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






