A8371212
4-Vinylbiphenyl , >98.0%(GC) , 2350-89-2
Synonym(s):
4-Phenylstyrene
CAS NO.:2350-89-2
Empirical Formula: C14H12
Molecular Weight: 180.25
MDL number: MFCD00008620
EINECS: 219-082-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25G | RMB1023.20 | In Stock |
|
| 100G | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-121 °C (lit.) |
| Boiling point: | 136-138 °C(Press: 6 Torr) |
| Density | 0.997 |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 2039221 |
| InChI | InChI=1S/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
| InChIKey | HDBWAWNLGGMZRQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(C=C)C=C1 |
| CAS DataBase Reference | 2350-89-2(CAS DataBase Reference) |
Description and Uses
4-Vinylbiphenyl intermediate is used in organic synthesis and in chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38-53 |
| Safety Statements | 26-36/37/39-35 |
| WGK Germany | 3 |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |




![3-[1,1′-Biphenyl]-4-yl-2-propenoic acid](https://img.chemicalbook.com/CAS/GIF/13026-23-8.gif)

