A8410912
2,4,6-Triisopropylbenzenesulfonyl azide , 97%, containing 15WT.%Water stabilizer , 36982-84-0
Synonym(s):
2,4,6-Triisopropylphenylsulfonyl azide;2,4,6-Tris(1-methylethyl)-benzenesulfonyl azide;Trisyl azide solution
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.84 | In Stock |
|
| 5G | RMB230.40 | In Stock |
|
| 25g | RMB937.44 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-44 °C |
| refractive index | n20/D1.499 |
| Flash point: | 4℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 2391566 |
| InChI | InChI=1S/C15H23N3O2S/c1-9(2)12-7-13(10(3)4)15(14(8-12)11(5)6)21(19,20)18-17-16/h7-11H,1-6H3 |
| InChIKey | AEMWUHCKKDPRSK-UHFFFAOYSA-N |
| SMILES | S(C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)(=O)(=O)N=[N+]=[N-] |
| CAS DataBase Reference | 36982-84-0(CAS DataBase Reference) |
Description and Uses
Reagent for:• ;Stereoselective diversity-oriented synthesis of functionalized saccharides1• ;Meyer′s lactamization2Reagent for synthesis of:• ;Antidote to anthrax lethal factor intoxication3• ;Bacterial RNA polymerase inhibitor4• ;Bicyclic extended dipeptide surrogates5• ;Single enantiomers of mycobacterial keomycolic acids6
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H302-H304-H315-H336-H361d-H373-H412 |
| Precautionary statements | P201-P210-P273-P301+P310+P331-P301+P312+P330-P308+P313 |
| Hazard Codes | T,Xn,F |
| Risk Statements | 36/37/38-25-67-65-48/20-38-22-11-63-5 |
| Safety Statements | 15-26-36-45-62-36/37-16-37 |
| RIDADR | UN1294 - class 3 - PG 2 - Toluene, solution |
| WGK Germany | 3 |
| HS Code | 29350090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |









