A8412812
5-Bromo-3-nitropyridine-2-carbonitrile , 95% , 573675-25-9
CAS NO.：573675-25-9
Empirical Formula: C6H2BrN3O2
Molecular Weight: 228
MDL number: MFCD06657551
EINECS: 629-442-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB281.60 | In Stock |
|
| 100g | RMB1120.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-106 °C |
| Boiling point: | 348.9±42.0 °C(Predicted) |
| Density | 1.92±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -6.71±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C6H2BrN3O2/c7-4-1-6(10(11)12)5(2-8)9-3-4/h1,3H |
| InChIKey | OBVYONPVHIOJJZ-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 573675-25-9(CAS DataBase Reference) |
Description and Uses
Used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H318-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 20/21-25-37/38-41 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
