A8418512
2-Chloro-4-pyridinecarboxaldehyde , 97% , 101066-61-9
Synonym(s):
2-Chloro-4-formylpyridine;2-Chloroisonicotinaldehyde
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB74.16 | In Stock |
|
| 5G | RMB250.56 | In Stock |
|
| 25g | RMB943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-50 °C |
| Boiling point: | 243.4±20.0 °C(Predicted) |
| Density | 1.332±0.06 g/cm3(Predicted) |
| Flash point: | >230 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -1.23±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Air Sensitive |
| BRN | 7986625 |
| InChI | InChI=1S/C6H4ClNO/c7-6-3-5(4-9)1-2-8-6/h1-4H |
| InChIKey | UFPOSTQMFOYHJI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C=O)=C1 |
| CAS DataBase Reference | 101066-61-9(CAS DataBase Reference) |
Description and Uses
2-Chloropyridine-4-carboxaldehyde is a reagent used in the chemoenzymic synthesis of α-fluoro β-hydroxy carboxylic esters. It is also a reagent in the combinatorial synthesis of methylene sulfonamides and related compounds as potential kinase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36-43-36/37/38-20/21/22-42/43 |
| Safety Statements | 26-36/37-36/37/39-22-45-23 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |







