A8419312
2-Amino-3-(trifluoromethyl)benzoic acid , 97% , 313-12-2
Synonym(s):
3-(Trifluoromethyl)anthranilic acid
CAS NO.：313-12-2
Empirical Formula: C8H6F3NO2
Molecular Weight: 205.13
MDL number: MFCD00274210
EINECS: 625-821-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1g | RMB44.80 | In Stock |
|
| 5g | RMB142.40 | In Stock |
|
| 25G | RMB386.40 | In Stock |
|
| 100G | RMB1471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-160 °C (lit.) |
| Boiling point: | 296.9±40.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 4.51±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| BRN | 2844022 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H6F3NO2/c9-8(10,11)5-3-1-2-4(6(5)12)7(13)14/h1-3H,12H2,(H,13,14) |
| InChIKey | UNLVJVQEDSDPIN-UHFFFAOYSA-N |
| SMILES | Nc1c(cccc1C(F)(F)F)C(O)=O |
| CAS DataBase Reference | 313-12-2(CAS DataBase Reference) |
Description and Uses
A useful intermediate for the syntheses of antimicrobial benzoisothiazolones and dithiobis(benzamides).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
