A8450912
Zearalenone from Giberella zeae , ≥98% , 17924-92-4
Synonym(s):
(3S,11E)-3,4,5,6,9,10-hexahydro-14,16-dihydroxy-3-methyl-,1H-2-benzoxacyclotetradecin-1,7(8H)-dione;F-2 toxin;ZON
CAS NO.:17924-92-4
Empirical Formula: C18H22O5
Molecular Weight: 318.36
MDL number: MFCD00133085
EINECS: 241-864-0
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB71.20 | In Stock |
|
| 10MG | RMB95.20 | In Stock |
|
| 25MG | RMB167.20 | In Stock |
|
| 100mg | RMB391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-165°C |
| alpha | 25546 -170.5° (c = 1.0 in CH3OH) |
| Boiling point: | 377.53°C (rough estimate) |
| Density | 1.1270 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| Flash point: | 6 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:7): 0.12 mg/ml; Ethanol: 20 mg/ml |
| pka | 7.58±0.40(Predicted) |
| form | Solid |
| color | Off-white |
| Merck | 13,10169 |
| BRN | 1350216 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C18H22O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,20-21H,2,4-6,8-9H2,1H3/b7-3+/t12-/m0/s1 |
| InChIKey | MBMQEIFVQACCCH-QBODLPLBSA-N |
| SMILES | OC1=C(C(O[C@@H](C)CCC2)=O)C(/C=C/CCCC2=O)=CC(O)=C1 |
| LogP | 3.830 (est) |
| CAS DataBase Reference | 17924-92-4(CAS DataBase Reference) |
| EPA Substance Registry System | Zearalenone (17924-92-4) |
Description and Uses
A phytoestrogenic mycotoxin and ER activator
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H361d |
| Precautionary statements | P202-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xn,F |
| Risk Statements | 34-62-63-36-20/21/22-11 |
| Safety Statements | 26-36/37/39-45-36-16-36/37 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM2550000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 17924-92-4(Hazardous Substances Data) |







