A8461712
trans-Zeatin-riboside , 97% , 6025-53-2
Synonym(s):
9-(β-D -Ribofuranosyl)-trans-zeatin;N6-(trans-4-Hydroxy-3-methyl-2-buten-1-yl)adenosine
CAS NO.：6025-53-2
Empirical Formula: C15H21N5O5
Molecular Weight: 351.36
MDL number: MFCD00036809
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB142.40 | In Stock |
|
| 50MG | RMB327.20 | In Stock |
|
| 100mg | RMB592.80 | In Stock |
|
| 250mg | RMB1110.40 | In Stock |
|
| 1g | RMB2783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-179 °C |
| Boiling point: | 485.17°C (rough estimate) |
| Density | 1.2018 (rough estimate) |
| refractive index | 1.7000 (estimate) |
| storage temp. | -20°C |
| solubility | acetic acid: 50 mg/mL, clear, colorless |
| pka | 13.11±0.70(Predicted) |
| form | Powder |
| color | White to off-white |
| biological source | synthetic (organic) |
| Water Solubility | slightly soluble |
| BRN | 5460894 |
| InChIKey | GOSWTRUMMSCNCW-HNNGNKQASA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)NC/C=C(\C)/CO)N=C2)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 6025-53-2(CAS DataBase Reference) |
Description and Uses
A well-known, highly active stimulant of cell divisions in plant tissue cultures
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29349990 |
